C26H20N6O2S2 — CID 137258597
2-[4-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]butylsulfanyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 137258597) has the molecular formula C26H20N6O2S2 and a molecular weight of 512.62 g/mol. Its IUPAC name is 2-[4-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]butylsulfanyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[4-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]butylsulfanyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 137258597 |
| Molecular Formula | C26H20N6O2S2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 2-[4-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]butylsulfanyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(SCCCCSc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)[nH]c1=O |
| InChI | InChI=1S/C26H20N6O2S2/c27-15-19-21(17-9-3-1-4-10-17)29-25(31-23(19)33)35-13-7-8-14-36-26-30-22(18-11-5-2-6-12-18)20(16-28)24(34)32-26/h1-6,9-12H,7-8,13-14H2,(H,29,31,33)(H,30,32,34) |
| InChIKey | NVSVFQBAKCLHAD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|