C18H12BrN3OS — CID 162675089
2-benzylsulfanyl-4-(3-bromophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 162675089) has the molecular formula C18H12BrN3OS and a molecular weight of 398.29 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-(3-bromophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-benzylsulfanyl-4-(3-bromophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 162675089 |
| Molecular Formula | C18H12BrN3OS |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 2-benzylsulfanyl-4-(3-bromophenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2cccc(Br)c2)nc(SCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C18H12BrN3OS/c19-14-8-4-7-13(9-14)16-15(10-20)17(23)22-18(21-16)24-11-12-5-2-1-3-6-12/h1-9H,11H2,(H,21,22,23) |
| InChIKey | AWRPQEKPYGVECN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|