C27H20N6O2S — CID 136968988
2-[[4-[4-(hydroxymethyl)triazol-1-yl]phenyl]methylsulfanyl]-6-oxo-4-(4-phenylphenyl)-1H-pyrimidine-5-carbonitrile (PubChem CID 136968988) has the molecular formula C27H20N6O2S and a molecular weight of 492.56 g/mol. Its IUPAC name is 2-[[4-[4-(hydroxymethyl)triazol-1-yl]phenyl]methylsulfanyl]-6-oxo-4-(4-phenylphenyl)-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[[4-[4-(hydroxymethyl)triazol-1-yl]phenyl]methylsulfanyl]-6-oxo-4-(4-phenylphenyl)-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 136968988 |
| Molecular Formula | C27H20N6O2S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[[4-[4-(hydroxymethyl)triazol-1-yl]phenyl]methylsulfanyl]-6-oxo-4-(4-phenylphenyl)-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(-c3ccccc3)cc2)nc(SCc2ccc(-n3cc(CO)nn3)cc2)[nH]c1=O |
| InChI | InChI=1S/C27H20N6O2S/c28-14-24-25(21-10-8-20(9-11-21)19-4-2-1-3-5-19)29-27(30-26(24)35)36-17-18-6-12-23(13-7-18)33-15-22(16-34)31-32-33/h1-13,15,34H,16-17H2,(H,29,30,35) |
| InChIKey | DPSLYAYIYNFVBH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|