C26H19N3O3S2 — CID 155818129
methyl 4-[[5-cyano-6-oxo-4-(4-phenylsulfanylphenyl)-1H-pyrimidin-2-yl]sulfanylmethyl]benzoate (PubChem CID 155818129) has the molecular formula C26H19N3O3S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is methyl 4-[[5-cyano-6-oxo-4-(4-phenylsulfanylphenyl)-1H-pyrimidin-2-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[5-cyano-6-oxo-4-(4-phenylsulfanylphenyl)-1H-pyrimidin-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 155818129 |
| Molecular Formula | C26H19N3O3S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | methyl 4-[[5-cyano-6-oxo-4-(4-phenylsulfanylphenyl)-1H-pyrimidin-2-yl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nc(-c3ccc(Sc4ccccc4)cc3)c(C#N)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C26H19N3O3S2/c1-32-25(31)19-9-7-17(8-10-19)16-33-26-28-23(22(15-27)24(30)29-26)18-11-13-21(14-12-18)34-20-5-3-2-4-6-20/h2-14H,16H2,1H3,(H,28,29,30) |
| InChIKey | URJAFIXCWZFLCS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|