C25H16F3N3O2S — CID 136968977
6-oxo-4-(4-phenoxyphenyl)-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1H-pyrimidine-5-carbonitrile (PubChem CID 136968977) has the molecular formula C25H16F3N3O2S and a molecular weight of 479.48 g/mol. Its IUPAC name is 6-oxo-4-(4-phenoxyphenyl)-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-oxo-4-(4-phenoxyphenyl)-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 136968977 |
| Molecular Formula | C25H16F3N3O2S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 6-oxo-4-(4-phenoxyphenyl)-2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Oc3ccccc3)cc2)nc(SCc2ccc(C(F)(F)F)cc2)[nH]c1=O |
| InChI | InChI=1S/C25H16F3N3O2S/c26-25(27,28)18-10-6-16(7-11-18)15-34-24-30-22(21(14-29)23(32)31-24)17-8-12-20(13-9-17)33-19-4-2-1-3-5-19/h1-13H,15H2,(H,30,31,32) |
| InChIKey | ATGWQBMOQANJTB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|