C18H11F3N4O2S — CID 168590233
2-methylsulfanyl-6-oxo-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-1H-pyrimidine-5-carbonitrile (PubChem CID 168590233) has the molecular formula C18H11F3N4O2S and a molecular weight of 404.37 g/mol. Its IUPAC name is 2-methylsulfanyl-6-oxo-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-6-oxo-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168590233 |
| Molecular Formula | C18H11F3N4O2S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-methylsulfanyl-6-oxo-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(Oc3ccc(C(F)(F)F)cn3)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C18H11F3N4O2S/c1-28-17-24-15(13(8-22)16(26)25-17)10-2-5-12(6-3-10)27-14-7-4-11(9-23-14)18(19,20)21/h2-7,9H,1H3,(H,24,25,26) |
| InChIKey | UFEXDQDRQLAERQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|