C22H14N4O5S — CID 135469379
(1,3-dioxoisoindol-2-yl)methyl 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetate (PubChem CID 135469379) has the molecular formula C22H14N4O5S and a molecular weight of 446.44 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 135469379 |
| Molecular Formula | C22H14N4O5S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetate |
| SMILES | N#Cc1c(-c2ccccc2)nc(SCC(=O)OCN2C(=O)c3ccccc3C2=O)[nH]c1=O |
| InChI | InChI=1S/C22H14N4O5S/c23-10-16-18(13-6-2-1-3-7-13)24-22(25-19(16)28)32-11-17(27)31-12-26-20(29)14-8-4-5-9-15(14)21(26)30/h1-9H,11-12H2,(H,24,25,28) |
| InChIKey | ZGDZONQNXRMWSM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|