C27H23N5O2S — CID 135464382
2-[[5-cyano-4-[4-(dimethylamino)phenyl]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide (PubChem CID 135464382) has the molecular formula C27H23N5O2S and a molecular weight of 481.58 g/mol. Its IUPAC name is 2-[[5-cyano-4-[4-(dimethylamino)phenyl]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide.
| Compound Name | 2-[[5-cyano-4-[4-(dimethylamino)phenyl]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 135464382 |
| Molecular Formula | C27H23N5O2S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-[[5-cyano-4-[4-(dimethylamino)phenyl]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N,N-diphenylacetamide |
| SMILES | CN(C)c1ccc(-c2nc(SCC(=O)N(c3ccccc3)c3ccccc3)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C27H23N5O2S/c1-31(2)20-15-13-19(14-16-20)25-23(17-28)26(34)30-27(29-25)35-18-24(33)32(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16H,18H2,1-2H3,(H,29,30,34) |
| InChIKey | QTTVKORBMLYODY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|