C20H24N4O2S — CID 135552495
2-[[5-cyano-4-(4-methylphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N,N-dipropylacetamide (PubChem CID 135552495) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 2-[[5-cyano-4-(4-methylphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N,N-dipropylacetamide.
| Compound Name | 2-[[5-cyano-4-(4-methylphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 135552495 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[[5-cyano-4-(4-methylphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CSc1nc(-c2ccc(C)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C20H24N4O2S/c1-4-10-24(11-5-2)17(25)13-27-20-22-18(16(12-21)19(26)23-20)15-8-6-14(3)7-9-15/h6-9H,4-5,10-11,13H2,1-3H3,(H,22,23,26) |
| InChIKey | WWSZRKRDWUASPI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|