C14H13ClN4O3S — CID 163326073
2-[[5-cyano-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide;hydrochloride (PubChem CID 163326073) has the molecular formula C14H13ClN4O3S and a molecular weight of 352.80 g/mol. Its IUPAC name is 2-[[5-cyano-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide;hydrochloride.
| Compound Name | 2-[[5-cyano-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 163326073 |
| Molecular Formula | C14H13ClN4O3S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-[[5-cyano-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide;hydrochloride |
| SMILES | COc1ccc(-c2nc(SCC(N)=O)[nH]c(=O)c2C#N)cc1.Cl |
| InChI | InChI=1S/C14H12N4O3S.ClH/c1-21-9-4-2-8(3-5-9)12-10(6-15)13(20)18-14(17-12)22-7-11(16)19;/h2-5H,7H2,1H3,(H2,16,19)(H,17,18,20);1H |
| InChIKey | PDOKTWGEQQOXRX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|