C20H16ClN5O5S — CID 163326036
2-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide;hydrochloride (PubChem CID 163326036) has the molecular formula C20H16ClN5O5S and a molecular weight of 473.90 g/mol. Its IUPAC name is 2-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide;hydrochloride.
| Compound Name | 2-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 163326036 |
| Molecular Formula | C20H16ClN5O5S |
| Molecular Weight | 473.90 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 2-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide;hydrochloride |
| SMILES | COc1cccc(-c2nc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)[nH]c(=O)c2C#N)c1.Cl |
| InChI | InChI=1S/C20H15N5O5S.ClH/c1-30-15-4-2-3-12(9-15)18-16(10-21)19(27)24-20(23-18)31-11-17(26)22-13-5-7-14(8-6-13)25(28)29;/h2-9H,11H2,1H3,(H,22,26)(H,23,24,27);1H |
| InChIKey | DIEJCJNCJKSRNJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 151.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.90 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|