C25H26N6O3S — CID 143201687
1-[4-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-3-piperidin-4-ylurea (PubChem CID 143201687) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is 1-[4-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-3-piperidin-4-ylurea.
| Compound Name | 1-[4-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 143201687 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-[4-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-3-piperidin-4-ylurea |
| SMILES | COc1cccc(-c2nc(SCc3ccc(NC(=O)NC4CCNCC4)cc3)[nH]c(=O)c2C#N)c1 |
| InChI | InChI=1S/C25H26N6O3S/c1-34-20-4-2-3-17(13-20)22-21(14-26)23(32)31-25(30-22)35-15-16-5-7-18(8-6-16)28-24(33)29-19-9-11-27-12-10-19/h2-8,13,19,27H,9-12,15H2,1H3,(H2,28,29,33)(H,30,31,32) |
| InChIKey | RIPMMUUMORLVCQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 131.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|