C28H24N4O5S — CID 143201752
N-[3-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-2,4-dimethoxybenzamide (PubChem CID 143201752) has the molecular formula C28H24N4O5S and a molecular weight of 528.59 g/mol. Its IUPAC name is N-[3-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[3-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 143201752 |
| Molecular Formula | C28H24N4O5S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | N-[3-[[5-cyano-4-(3-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]sulfanylmethyl]phenyl]-2,4-dimethoxybenzamide |
| SMILES | COc1cccc(-c2nc(SCc3cccc(NC(=O)c4ccc(OC)cc4OC)c3)[nH]c(=O)c2C#N)c1 |
| InChI | InChI=1S/C28H24N4O5S/c1-35-20-9-5-7-18(13-20)25-23(15-29)27(34)32-28(31-25)38-16-17-6-4-8-19(12-17)30-26(33)22-11-10-21(36-2)14-24(22)37-3/h4-14H,16H2,1-3H3,(H,30,33)(H,31,32,34) |
| InChIKey | BUDFTIMQOTWIDK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|