C19H21NO5S — CID 119241227
3-[[3-[(2,4-dimethoxybenzoyl)amino]phenyl]methylsulfanyl]propanoic acid (PubChem CID 119241227) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 3-[[3-[(2,4-dimethoxybenzoyl)amino]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[(2,4-dimethoxybenzoyl)amino]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 119241227 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 3-[[3-[(2,4-dimethoxybenzoyl)amino]phenyl]methylsulfanyl]propanoic acid |
| SMILES | COc1ccc(C(=O)Nc2cccc(CSCCC(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C19H21NO5S/c1-24-15-6-7-16(17(11-15)25-2)19(23)20-14-5-3-4-13(10-14)12-26-9-8-18(21)22/h3-7,10-11H,8-9,12H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | DQTMWNWDPQZIQE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|