C18H21N3O3S — CID 120526348
3-[[3-[(5-cyclopropyl-1-methylpyrazole-4-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid (PubChem CID 120526348) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-[[3-[(5-cyclopropyl-1-methylpyrazole-4-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[(5-cyclopropyl-1-methylpyrazole-4-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 120526348 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-[[3-[(5-cyclopropyl-1-methylpyrazole-4-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid |
| SMILES | Cn1ncc(C(=O)Nc2cccc(CSCCC(=O)O)c2)c1C1CC1 |
| InChI | InChI=1S/C18H21N3O3S/c1-21-17(13-5-6-13)15(10-19-21)18(24)20-14-4-2-3-12(9-14)11-25-8-7-16(22)23/h2-4,9-10,13H,5-8,11H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | QFWKVTMQXNDWMI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|