C16H17N3O3S — CID 119240713
2-[[3-[(5-cyclopropyl-1H-pyrazole-3-carbonyl)amino]phenyl]methylsulfanyl]acetic acid (PubChem CID 119240713) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[[3-[(5-cyclopropyl-1H-pyrazole-3-carbonyl)amino]phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[3-[(5-cyclopropyl-1H-pyrazole-3-carbonyl)amino]phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119240713 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[[3-[(5-cyclopropyl-1H-pyrazole-3-carbonyl)amino]phenyl]methylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCc1cccc(NC(=O)c2cc(C3CC3)[nH]n2)c1 |
| InChI | InChI=1S/C16H17N3O3S/c20-15(21)9-23-8-10-2-1-3-12(6-10)17-16(22)14-7-13(18-19-14)11-4-5-11/h1-3,6-7,11H,4-5,8-9H2,(H,17,22)(H,18,19)(H,20,21) |
| InChIKey | GKRLVMZVTXIYAA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |