C17H16N6OS — CID 145039700
5-cyclopropyl-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-1H-pyrazole-3-carboxamide (PubChem CID 145039700) has the molecular formula C17H16N6OS and a molecular weight of 352.42 g/mol. Its IUPAC name is 5-cyclopropyl-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 145039700 |
| Molecular Formula | C17H16N6OS |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 5-cyclopropyl-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(SNc2ncccn2)cc1)c1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C17H16N6OS/c24-16(15-10-14(21-22-15)11-2-3-11)20-12-4-6-13(7-5-12)25-23-17-18-8-1-9-19-17/h1,4-11H,2-3H2,(H,20,24)(H,21,22)(H,18,19,23) |
| InChIKey | QBHZWXSVCIWZQT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|