C13H11N7OS — CID 145039639
N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 145039639) has the molecular formula C13H11N7OS and a molecular weight of 313.35 g/mol. Its IUPAC name is N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 145039639 |
| Molecular Formula | C13H11N7OS |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(SNc2ncccn2)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C13H11N7OS/c21-12(11-16-8-17-19-11)18-9-2-4-10(5-3-9)22-20-13-14-6-1-7-15-13/h1-8H,(H,18,21)(H,14,15,20)(H,16,17,19) |
| InChIKey | VIWAKQUOINLVKZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|