C23H22N6OS — CID 145039706
3-phenyl-1-propyl-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]pyrazole-5-carboxamide (PubChem CID 145039706) has the molecular formula C23H22N6OS and a molecular weight of 430.54 g/mol. Its IUPAC name is 3-phenyl-1-propyl-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]pyrazole-5-carboxamide.
| Compound Name | 3-phenyl-1-propyl-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 145039706 |
| Molecular Formula | C23H22N6OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-phenyl-1-propyl-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]pyrazole-5-carboxamide |
| SMILES | CCCn1nc(-c2ccccc2)cc1C(=O)Nc1ccc(SNc2ncccn2)cc1 |
| InChI | InChI=1S/C23H22N6OS/c1-2-15-29-21(16-20(27-29)17-7-4-3-5-8-17)22(30)26-18-9-11-19(12-10-18)31-28-23-24-13-6-14-25-23/h3-14,16H,2,15H2,1H3,(H,26,30)(H,24,25,28) |
| InChIKey | LSNNMEOYICUDDN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|