C24H20N4O4S — CID 118947290
N-[4-(benzoylsulfamoyl)phenyl]-1-methyl-3-phenylpyrazole-5-carboxamide (PubChem CID 118947290) has the molecular formula C24H20N4O4S and a molecular weight of 460.52 g/mol. Its IUPAC name is N-[4-(benzoylsulfamoyl)phenyl]-1-methyl-3-phenylpyrazole-5-carboxamide.
| Compound Name | N-[4-(benzoylsulfamoyl)phenyl]-1-methyl-3-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118947290 |
| Molecular Formula | C24H20N4O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[4-(benzoylsulfamoyl)phenyl]-1-methyl-3-phenylpyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccccc2)cc1C(=O)Nc1ccc(S(=O)(=O)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N4O4S/c1-28-22(16-21(26-28)17-8-4-2-5-9-17)24(30)25-19-12-14-20(15-13-19)33(31,32)27-23(29)18-10-6-3-7-11-18/h2-16H,1H3,(H,25,30)(H,27,29) |
| InChIKey | JICYMVHHTHCRPO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |