C25H20N6O2 — CID 122307817
1-methyl-3-phenyl-N-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]pyrazole-5-carboxamide (PubChem CID 122307817) has the molecular formula C25H20N6O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is 1-methyl-3-phenyl-N-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]pyrazole-5-carboxamide.
| Compound Name | 1-methyl-3-phenyl-N-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122307817 |
| Molecular Formula | C25H20N6O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-methyl-3-phenyl-N-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]pyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccccc2)cc1C(=O)Nc1ccc(Oc2ccc(-n3cccc3)nn2)cc1 |
| InChI | InChI=1S/C25H20N6O2/c1-30-22(17-21(29-30)18-7-3-2-4-8-18)25(32)26-19-9-11-20(12-10-19)33-24-14-13-23(27-28-24)31-15-5-6-16-31/h2-17H,1H3,(H,26,32) |
| InChIKey | SCWBGNYFMWGEOT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |