C23H21N5O4 — CID 122307713
1-(3,5-dimethoxyphenyl)-3-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]urea (PubChem CID 122307713) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 122307713 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(Oc3ccc(-n4cccc4)nn3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C23H21N5O4/c1-30-19-13-17(14-20(15-19)31-2)25-23(29)24-16-5-7-18(8-6-16)32-22-10-9-21(26-27-22)28-11-3-4-12-28/h3-15H,1-2H3,(H2,24,25,29) |
| InChIKey | BBAGJVQQUMSDKL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |