C24H23N5O5 — CID 122309166
1-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 122309166) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is 1-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 122309166 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 1-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(Oc3cc(-n4cccc4)ncn3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23N5O5/c1-31-19-12-17(13-20(32-2)23(19)33-3)28-24(30)27-16-6-8-18(9-7-16)34-22-14-21(25-15-26-22)29-10-4-5-11-29/h4-15H,1-3H3,(H2,27,28,30) |
| InChIKey | GZSJMAFDPGZSOF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |