C21H16ClN5O2 — CID 122308884
1-(3-chlorophenyl)-3-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]urea (PubChem CID 122308884) has the molecular formula C21H16ClN5O2 and a molecular weight of 405.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 122308884 |
| Molecular Formula | C21H16ClN5O2 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2cc(-n3cccc3)ncn2)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H16ClN5O2/c22-15-4-3-5-17(12-15)26-21(28)25-16-6-8-18(9-7-16)29-20-13-19(23-14-24-20)27-10-1-2-11-27/h1-14H,(H2,25,26,28) |
| InChIKey | DGEJMHIASZHMKT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |