C21H14N6O6 — CID 122309180
3,5-dinitro-N-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]benzamide (PubChem CID 122309180) has the molecular formula C21H14N6O6 and a molecular weight of 446.38 g/mol. Its IUPAC name is 3,5-dinitro-N-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]benzamide.
| Compound Name | 3,5-dinitro-N-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]benzamide |
|---|---|
| PubChem CID | 122309180 |
| Molecular Formula | C21H14N6O6 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 3,5-dinitro-N-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]benzamide |
| SMILES | O=C(Nc1ccc(Oc2cc(-n3cccc3)ncn2)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14N6O6/c28-21(14-9-16(26(29)30)11-17(10-14)27(31)32)24-15-3-5-18(6-4-15)33-20-12-19(22-13-23-20)25-7-1-2-8-25/h1-13H,(H,24,28) |
| InChIKey | LHHXUVPZANTMFM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|