C23H22N6O5 — CID 122312189
1-[4-(6-imidazol-1-ylpyrimidin-4-yl)oxyphenyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 122312189) has the molecular formula C23H22N6O5 and a molecular weight of 462.47 g/mol. Its IUPAC name is 1-[4-(6-imidazol-1-ylpyrimidin-4-yl)oxyphenyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[4-(6-imidazol-1-ylpyrimidin-4-yl)oxyphenyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 122312189 |
| Molecular Formula | C23H22N6O5 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 1-[4-(6-imidazol-1-ylpyrimidin-4-yl)oxyphenyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(Oc3cc(-n4ccnc4)ncn3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H22N6O5/c1-31-18-10-16(11-19(32-2)22(18)33-3)28-23(30)27-15-4-6-17(7-5-15)34-21-12-20(25-13-26-21)29-9-8-24-14-29/h4-14H,1-3H3,(H2,27,28,30) |
| InChIKey | BLGFMZQPBQMCFQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |