C18H13N5O2S — CID 122312000
N-[4-(6-imidazol-1-ylpyrimidin-4-yl)oxyphenyl]thiophene-3-carboxamide (PubChem CID 122312000) has the molecular formula C18H13N5O2S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-[4-(6-imidazol-1-ylpyrimidin-4-yl)oxyphenyl]thiophene-3-carboxamide.
| Compound Name | N-[4-(6-imidazol-1-ylpyrimidin-4-yl)oxyphenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 122312000 |
| Molecular Formula | C18H13N5O2S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-[4-(6-imidazol-1-ylpyrimidin-4-yl)oxyphenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2cc(-n3ccnc3)ncn2)cc1)c1ccsc1 |
| InChI | InChI=1S/C18H13N5O2S/c24-18(13-5-8-26-10-13)22-14-1-3-15(4-2-14)25-17-9-16(20-11-21-17)23-7-6-19-12-23/h1-12H,(H,22,24) |
| InChIKey | CMTNPYRKYDBZSH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |