C22H15ClF3N5O2 — CID 122307737
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]urea (PubChem CID 122307737) has the molecular formula C22H15ClF3N5O2 and a molecular weight of 473.84 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 122307737 |
| Molecular Formula | C22H15ClF3N5O2 |
| Molecular Weight | 473.84 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(6-pyrrol-1-ylpyridazin-3-yl)oxyphenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2ccc(-n3cccc3)nn2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H15ClF3N5O2/c23-18-8-5-15(13-17(18)22(24,25)26)28-21(32)27-14-3-6-16(7-4-14)33-20-10-9-19(29-30-20)31-11-1-2-12-31/h1-13H,(H2,27,28,32) |
| InChIKey | XSAVOCPQYGDZEJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.84 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |