C19H27N3O4S — CID 160542881
N-[4-(dimethylcarbamoylamino)phenyl]sulfonylbenzamide;ethane;methane (PubChem CID 160542881) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[4-(dimethylcarbamoylamino)phenyl]sulfonylbenzamide;ethane;methane.
| Compound Name | N-[4-(dimethylcarbamoylamino)phenyl]sulfonylbenzamide;ethane;methane |
|---|---|
| PubChem CID | 160542881 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[4-(dimethylcarbamoylamino)phenyl]sulfonylbenzamide;ethane;methane |
| SMILES | C.CC.CN(C)C(=O)Nc1ccc(S(=O)(=O)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17N3O4S.C2H6.CH4/c1-19(2)16(21)17-13-8-10-14(11-9-13)24(22,23)18-15(20)12-6-4-3-5-7-12;1-2;/h3-11H,1-2H3,(H,17,21)(H,18,20);1-2H3;1H4 |
| InChIKey | QXAIRAZOTXHDKN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |