C15H14N4O5S — CID 21204126
N-[4-[(2-hydrazinyl-2-oxoacetyl)sulfamoyl]phenyl]benzamide (PubChem CID 21204126) has the molecular formula C15H14N4O5S and a molecular weight of 362.37 g/mol. Its IUPAC name is N-[4-[(2-hydrazinyl-2-oxoacetyl)sulfamoyl]phenyl]benzamide.
| Compound Name | N-[4-[(2-hydrazinyl-2-oxoacetyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 21204126 |
| Molecular Formula | C15H14N4O5S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-[4-[(2-hydrazinyl-2-oxoacetyl)sulfamoyl]phenyl]benzamide |
| SMILES | NNC(=O)C(=O)NS(=O)(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H14N4O5S/c16-18-14(21)15(22)19-25(23,24)12-8-6-11(7-9-12)17-13(20)10-4-2-1-3-5-10/h1-9H,16H2,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | ZEOAQAMIKSVHHF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|