C16H15NO5S — CID 18368976
3-(4-benzamidophenyl)sulfonylpropanoic acid (PubChem CID 18368976) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is 3-(4-benzamidophenyl)sulfonylpropanoic acid.
| Compound Name | 3-(4-benzamidophenyl)sulfonylpropanoic acid |
|---|---|
| PubChem CID | 18368976 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-(4-benzamidophenyl)sulfonylpropanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15NO5S/c18-15(19)10-11-23(21,22)14-8-6-13(7-9-14)17-16(20)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,17,20)(H,18,19) |
| InChIKey | UQDBTRBPXXSKAC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |