C17H17NO6S — CID 18683964
3-[4-[(2-methoxybenzoyl)amino]phenyl]sulfonylpropanoic acid (PubChem CID 18683964) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is 3-[4-[(2-methoxybenzoyl)amino]phenyl]sulfonylpropanoic acid.
| Compound Name | 3-[4-[(2-methoxybenzoyl)amino]phenyl]sulfonylpropanoic acid |
|---|---|
| PubChem CID | 18683964 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-[4-[(2-methoxybenzoyl)amino]phenyl]sulfonylpropanoic acid |
| SMILES | COc1ccccc1C(=O)Nc1ccc(S(=O)(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C17H17NO6S/c1-24-15-5-3-2-4-14(15)17(21)18-12-6-8-13(9-7-12)25(22,23)11-10-16(19)20/h2-9H,10-11H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | PBDUVGVVKLVJGP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |