C18H18O8S2 — CID 2192651
3-[4-[4-(2-carboxyethylsulfonyl)phenyl]phenyl]sulfonylpropanoic acid (PubChem CID 2192651) has the molecular formula C18H18O8S2 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3-[4-[4-(2-carboxyethylsulfonyl)phenyl]phenyl]sulfonylpropanoic acid.
| Compound Name | 3-[4-[4-(2-carboxyethylsulfonyl)phenyl]phenyl]sulfonylpropanoic acid |
|---|---|
| PubChem CID | 2192651 |
| Molecular Formula | C18H18O8S2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 3-[4-[4-(2-carboxyethylsulfonyl)phenyl]phenyl]sulfonylpropanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)c1ccc(-c2ccc(S(=O)(=O)CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H18O8S2/c19-17(20)9-11-27(23,24)15-5-1-13(2-6-15)14-3-7-16(8-4-14)28(25,26)12-10-18(21)22/h1-8H,9-12H2,(H,19,20)(H,21,22) |
| InChIKey | CXTJUXFZSPQSIY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |