C15H12F3NO3S — CID 174889531
N-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]benzamide (PubChem CID 174889531) has the molecular formula C15H12F3NO3S and a molecular weight of 343.33 g/mol. Its IUPAC name is N-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]benzamide.
| Compound Name | N-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 174889531 |
| Molecular Formula | C15H12F3NO3S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)CC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H12F3NO3S/c16-15(17,18)10-23(21,22)13-8-6-12(7-9-13)19-14(20)11-4-2-1-3-5-11/h1-9H,10H2,(H,19,20) |
| InChIKey | FABYFIKJEUHIEE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |