C14H10ClNO5S — CID 164925854
4-[(4-chlorosulfonylbenzoyl)amino]benzoic acid (PubChem CID 164925854) has the molecular formula C14H10ClNO5S and a molecular weight of 339.76 g/mol. Its IUPAC name is 4-[(4-chlorosulfonylbenzoyl)amino]benzoic acid.
| Compound Name | 4-[(4-chlorosulfonylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 164925854 |
| Molecular Formula | C14H10ClNO5S |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 4-[(4-chlorosulfonylbenzoyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc(S(=O)(=O)Cl)cc2)cc1 |
| InChI | InChI=1S/C14H10ClNO5S/c15-22(20,21)12-7-3-9(4-8-12)13(17)16-11-5-1-10(2-6-11)14(18)19/h1-8H,(H,16,17)(H,18,19) |
| InChIKey | OLNYFHPDYZCQRQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |