C16H14N2O7S — CID 22456332
4-[[4-(carboxymethylsulfamoyl)phenyl]carbamoyl]benzoic acid (PubChem CID 22456332) has the molecular formula C16H14N2O7S and a molecular weight of 378.36 g/mol. Its IUPAC name is 4-[[4-(carboxymethylsulfamoyl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 4-[[4-(carboxymethylsulfamoyl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22456332 |
| Molecular Formula | C16H14N2O7S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 4-[[4-(carboxymethylsulfamoyl)phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(NC(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H14N2O7S/c19-14(20)9-17-26(24,25)13-7-5-12(6-8-13)18-15(21)10-1-3-11(4-2-10)16(22)23/h1-8,17H,9H2,(H,18,21)(H,19,20)(H,22,23) |
| InChIKey | FVJPTMJRUPHXJI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |