C13H10ClNO4S — CID 87188677
[4-(4-chlorosulfonylphenyl)phenyl]carbamic acid (PubChem CID 87188677) has the molecular formula C13H10ClNO4S and a molecular weight of 311.75 g/mol. Its IUPAC name is [4-(4-chlorosulfonylphenyl)phenyl]carbamic acid.
| Compound Name | [4-(4-chlorosulfonylphenyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 87188677 |
| Molecular Formula | C13H10ClNO4S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | [4-(4-chlorosulfonylphenyl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(-c2ccc(S(=O)(=O)Cl)cc2)cc1 |
| InChI | InChI=1S/C13H10ClNO4S/c14-20(18,19)12-7-3-10(4-8-12)9-1-5-11(6-2-9)15-13(16)17/h1-8,15H,(H,16,17) |
| InChIKey | QYPVAKKFLXDIBP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |