C9H6ClF4NO3S — CID 114032743
4-(2,2,3,3-tetrafluoropropanoylamino)benzenesulfonyl chloride (PubChem CID 114032743) has the molecular formula C9H6ClF4NO3S and a molecular weight of 319.66 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropanoylamino)benzenesulfonyl chloride.
| Compound Name | 4-(2,2,3,3-tetrafluoropropanoylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 114032743 |
| Molecular Formula | C9H6ClF4NO3S |
| Molecular Weight | 319.66 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropanoylamino)benzenesulfonyl chloride |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Cl)cc1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H6ClF4NO3S/c10-19(17,18)6-3-1-5(2-4-6)15-8(16)9(13,14)7(11)12/h1-4,7H,(H,15,16) |
| InChIKey | ZSIBRPFMEUGOLB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|