C9H6F5NO — CID 103731851
2,2,3,3-tetrafluoro-N-(4-fluorophenyl)propanamide (PubChem CID 103731851) has the molecular formula C9H6F5NO and a molecular weight of 239.14 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(4-fluorophenyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 103731851 |
| Molecular Formula | C9H6F5NO |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(4-fluorophenyl)propanamide |
| SMILES | O=C(Nc1ccc(F)cc1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H6F5NO/c10-5-1-3-6(4-2-5)15-8(16)9(13,14)7(11)12/h1-4,7H,(H,15,16) |
| InChIKey | BDFGXAGMBCONPW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|