C11H11ClF4N2O — CID 119473799
N-(2,3-dihydro-1H-indol-5-yl)-2,2,3,3-tetrafluoropropanamide;hydrochloride (PubChem CID 119473799) has the molecular formula C11H11ClF4N2O and a molecular weight of 298.67 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)-2,2,3,3-tetrafluoropropanamide;hydrochloride.
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)-2,2,3,3-tetrafluoropropanamide;hydrochloride |
|---|---|
| PubChem CID | 119473799 |
| Molecular Formula | C11H11ClF4N2O |
| Molecular Weight | 298.67 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)-2,2,3,3-tetrafluoropropanamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc2c(c1)CCN2)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H10F4N2O.ClH/c12-9(13)11(14,15)10(18)17-7-1-2-8-6(5-7)3-4-16-8;/h1-2,5,9,16H,3-4H2,(H,17,18);1H |
| InChIKey | ATEHNZFLKZWROH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.67 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|