C12H16N2O2 — CID 115736922
N-(2,3-dihydro-1H-indol-5-yl)-2-methoxypropanamide (PubChem CID 115736922) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-yl)-2-methoxypropanamide.
| Compound Name | N-(2,3-dihydro-1H-indol-5-yl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 115736922 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-yl)-2-methoxypropanamide |
| SMILES | COC(C)C(=O)Nc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C12H16N2O2/c1-8(16-2)12(15)14-10-3-4-11-9(7-10)5-6-13-11/h3-4,7-8,13H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | JQQXUEJURBNWBS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |