C13H19N3O — CID 79161283
3-(2,3-dihydro-1H-indol-5-yl)-1,1-diethylurea (PubChem CID 79161283) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-5-yl)-1,1-diethylurea.
| Compound Name | 3-(2,3-dihydro-1H-indol-5-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 79161283 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-5-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C13H19N3O/c1-3-16(4-2)13(17)15-11-5-6-12-10(9-11)7-8-14-12/h5-6,9,14H,3-4,7-8H2,1-2H3,(H,15,17) |
| InChIKey | JOSMYLBPWLJWSL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |