C10H6BrF4NO3 — CID 114032535
2-bromo-5-(2,2,3,3-tetrafluoropropanoylamino)benzoic acid (PubChem CID 114032535) has the molecular formula C10H6BrF4NO3 and a molecular weight of 344.06 g/mol. Its IUPAC name is 2-bromo-5-(2,2,3,3-tetrafluoropropanoylamino)benzoic acid.
| Compound Name | 2-bromo-5-(2,2,3,3-tetrafluoropropanoylamino)benzoic acid |
|---|---|
| PubChem CID | 114032535 |
| Molecular Formula | C10H6BrF4NO3 |
| Molecular Weight | 344.06 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | 2-bromo-5-(2,2,3,3-tetrafluoropropanoylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)C(F)(F)C(F)F)ccc1Br |
| InChI | InChI=1S/C10H6BrF4NO3/c11-6-2-1-4(3-5(6)7(17)18)16-9(19)10(14,15)8(12)13/h1-3,8H,(H,16,19)(H,17,18) |
| InChIKey | HENMTJDHGAJXHO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.06 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|