C11H10BrF3N2O3 — CID 115296752
2-bromo-5-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]benzoic acid (PubChem CID 115296752) has the molecular formula C11H10BrF3N2O3 and a molecular weight of 355.11 g/mol. Its IUPAC name is 2-bromo-5-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]benzoic acid.
| Compound Name | 2-bromo-5-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 115296752 |
| Molecular Formula | C11H10BrF3N2O3 |
| Molecular Weight | 355.11 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 2-bromo-5-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]benzoic acid |
| SMILES | CN(CC(F)(F)F)C(=O)Nc1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H10BrF3N2O3/c1-17(5-11(13,14)15)10(20)16-6-2-3-8(12)7(4-6)9(18)19/h2-4H,5H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | KHIDXRAUECYQFU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.11 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |