C30H26N2O6Si — CID 102014802
4-[[4-[[4-[(4-carboxyphenyl)carbamoyl]phenyl]-dimethylsilyl]benzoyl]amino]benzoic acid (PubChem CID 102014802) has the molecular formula C30H26N2O6Si and a molecular weight of 538.63 g/mol. Its IUPAC name is 4-[[4-[[4-[(4-carboxyphenyl)carbamoyl]phenyl]-dimethylsilyl]benzoyl]amino]benzoic acid.
| Compound Name | 4-[[4-[[4-[(4-carboxyphenyl)carbamoyl]phenyl]-dimethylsilyl]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 102014802 |
| Molecular Formula | C30H26N2O6Si |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 4-[[4-[[4-[(4-carboxyphenyl)carbamoyl]phenyl]-dimethylsilyl]benzoyl]amino]benzoic acid |
| SMILES | C[Si](C)(c1ccc(C(=O)Nc2ccc(C(=O)O)cc2)cc1)c1ccc(C(=O)Nc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H26N2O6Si/c1-39(2,25-15-7-19(8-16-25)27(33)31-23-11-3-21(4-12-23)29(35)36)26-17-9-20(10-18-26)28(34)32-24-13-5-22(6-14-24)30(37)38/h3-18H,1-2H3,(H,31,33)(H,32,34)(H,35,36)(H,37,38) |
| InChIKey | BOGOJDFWBVOHPC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|