C18H17N3O5 — CID 3293283
4-[2-(4-benzamidobenzoyl)hydrazinyl]-4-oxobutanoic acid (PubChem CID 3293283) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[2-(4-benzamidobenzoyl)hydrazinyl]-4-oxobutanoic acid.
| Compound Name | 4-[2-(4-benzamidobenzoyl)hydrazinyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3293283 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-[2-(4-benzamidobenzoyl)hydrazinyl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NNC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N3O5/c22-15(10-11-16(23)24)20-21-18(26)13-6-8-14(9-7-13)19-17(25)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,19,25)(H,20,22)(H,21,26)(H,23,24) |
| InChIKey | AHXMDTSUYPRMJR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|