C19H14F2N6OS — CID 145039648
2-(difluoromethyl)-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 145039648) has the molecular formula C19H14F2N6OS and a molecular weight of 412.43 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(difluoromethyl)-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 145039648 |
| Molecular Formula | C19H14F2N6OS |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-(difluoromethyl)-N-[4-(pyrimidin-2-ylamino)sulfanylphenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(SNc2ncccn2)cc1)c1ccc2nc(C(F)F)[nH]c2c1 |
| InChI | InChI=1S/C19H14F2N6OS/c20-16(21)17-25-14-7-2-11(10-15(14)26-17)18(28)24-12-3-5-13(6-4-12)29-27-19-22-8-1-9-23-19/h1-10,16H,(H,24,28)(H,25,26)(H,22,23,27) |
| InChIKey | LCEQBQQMRSYNFN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|