C19H18F2N4O4 — CID 56561529
2-methoxyethyl N-[3-[[2-(difluoromethyl)-3H-benzimidazole-5-carbonyl]amino]phenyl]carbamate (PubChem CID 56561529) has the molecular formula C19H18F2N4O4 and a molecular weight of 404.37 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[[2-(difluoromethyl)-3H-benzimidazole-5-carbonyl]amino]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[[2-(difluoromethyl)-3H-benzimidazole-5-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 56561529 |
| Molecular Formula | C19H18F2N4O4 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-methoxyethyl N-[3-[[2-(difluoromethyl)-3H-benzimidazole-5-carbonyl]amino]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1cccc(NC(=O)c2ccc3nc(C(F)F)[nH]c3c2)c1 |
| InChI | InChI=1S/C19H18F2N4O4/c1-28-7-8-29-19(27)23-13-4-2-3-12(10-13)22-18(26)11-5-6-14-15(9-11)25-17(24-14)16(20)21/h2-6,9-10,16H,7-8H2,1H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | VTNOPGWDQJDPET-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|