C22H21N5OS — CID 166899770
2-(2-aminoethyl)-N-(4-anilinosulfanylphenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 166899770) has the molecular formula C22H21N5OS and a molecular weight of 403.51 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-(4-anilinosulfanylphenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-(4-anilinosulfanylphenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 166899770 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-(2-aminoethyl)-N-(4-anilinosulfanylphenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | NCCc1nc2ccc(C(=O)Nc3ccc(SNc4ccccc4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C22H21N5OS/c23-13-12-21-25-19-11-6-15(14-20(19)26-21)22(28)24-16-7-9-18(10-8-16)29-27-17-4-2-1-3-5-17/h1-11,14,27H,12-13,23H2,(H,24,28)(H,25,26) |
| InChIKey | MKJCFGPZTIMPJP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|