C16H21NO5S2 — CID 120526370
3-[[3-[(1,1-dioxothiane-2-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid (PubChem CID 120526370) has the molecular formula C16H21NO5S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-[[3-[(1,1-dioxothiane-2-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[(1,1-dioxothiane-2-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 120526370 |
| Molecular Formula | C16H21NO5S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-[[3-[(1,1-dioxothiane-2-carbonyl)amino]phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(NC(=O)C2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C16H21NO5S2/c18-15(19)7-8-23-11-12-4-3-5-13(10-12)17-16(20)14-6-1-2-9-24(14,21)22/h3-5,10,14H,1-2,6-9,11H2,(H,17,20)(H,18,19) |
| InChIKey | FIBPUWWBVOZWQM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|